C20H26FNO3 — CID 93147109
(2R)-1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenoxypropan-2-ol (PubChem CID 93147109) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93147109 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-phenoxypropan-2-ol |
| SMILES | COCCCN(Cc1ccccc1F)C[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C20H26FNO3/c1-24-13-7-12-22(14-17-8-5-6-11-20(17)21)15-18(23)16-25-19-9-3-2-4-10-19/h2-6,8-11,18,23H,7,12-16H2,1H3/t18-/m1/s1 |
| InChIKey | LMJULQBSEQFOPS-GOSISDBHSA-N |
| XLogP | 3.10 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|