C21H27ClFNO2 — CID 93147028
(2S)-1-(4-chlorophenoxy)-3-[(2-fluorophenyl)methyl-(3-methylbutyl)amino]propan-2-ol (PubChem CID 93147028) has the molecular formula C21H27ClFNO2 and a molecular weight of 379.90 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-[(2-fluorophenyl)methyl-(3-methylbutyl)amino]propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-[(2-fluorophenyl)methyl-(3-methylbutyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 93147028 |
| Molecular Formula | C21H27ClFNO2 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-[(2-fluorophenyl)methyl-(3-methylbutyl)amino]propan-2-ol |
| SMILES | CC(C)CCN(Cc1ccccc1F)C[C@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClFNO2/c1-16(2)11-12-24(13-17-5-3-4-6-21(17)23)14-19(25)15-26-20-9-7-18(22)8-10-20/h3-10,16,19,25H,11-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | CTMUPZCITTVMFQ-IBGZPJMESA-N |
| XLogP | 4.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |