C19H24FNO2 — CID 93164345
(2R)-1-[(2-fluorophenyl)methyl-propan-2-ylamino]-3-phenoxypropan-2-ol (PubChem CID 93164345) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methyl-propan-2-ylamino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methyl-propan-2-ylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93164345 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methyl-propan-2-ylamino]-3-phenoxypropan-2-ol |
| SMILES | CC(C)N(Cc1ccccc1F)C[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C19H24FNO2/c1-15(2)21(12-16-8-6-7-11-19(16)20)13-17(22)14-23-18-9-4-3-5-10-18/h3-11,15,17,22H,12-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | ARBMSFGVULMJTE-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |