C13H28N2O2 — CID 82850125
3-[3-aminopropyl(cycloheptyl)amino]propane-1,2-diol (PubChem CID 82850125) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[3-aminopropyl(cycloheptyl)amino]propane-1,2-diol.
| Compound Name | 3-[3-aminopropyl(cycloheptyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 82850125 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-[3-aminopropyl(cycloheptyl)amino]propane-1,2-diol |
| SMILES | NCCCN(CC(O)CO)C1CCCCCC1 |
| InChI | InChI=1S/C13H28N2O2/c14-8-5-9-15(10-13(17)11-16)12-6-3-1-2-4-7-12/h12-13,16-17H,1-11,14H2 |
| InChIKey | FGKSRSCEVKDJKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |