C13H27NO2 — CID 82850075
3-[cyclopentyl(3-methylbutyl)amino]propane-1,2-diol (PubChem CID 82850075) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 3-[cyclopentyl(3-methylbutyl)amino]propane-1,2-diol.
| Compound Name | 3-[cyclopentyl(3-methylbutyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 82850075 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 3-[cyclopentyl(3-methylbutyl)amino]propane-1,2-diol |
| SMILES | CC(C)CCN(CC(O)CO)C1CCCC1 |
| InChI | InChI=1S/C13H27NO2/c1-11(2)7-8-14(9-13(16)10-15)12-5-3-4-6-12/h11-13,15-16H,3-10H2,1-2H3 |
| InChIKey | NFMNJQKFOIVGBX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |