C31H54N5O11+ — CID 142755282
N-[2-[4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]piperidin-1-yl]ethyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide (PubChem CID 142755282) has the molecular formula C31H54N5O11+ and a molecular weight of 672.80 g/mol. Its IUPAC name is N-[2-[4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]piperidin-1-yl]ethyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide.
| Compound Name | N-[2-[4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]piperidin-1-yl]ethyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 142755282 |
| Molecular Formula | C31H54N5O11+ |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | N-[2-[4-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]piperidin-1-yl]ethyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide |
| SMILES | CCn1c[n+](CC)c2ccc(C(=O)NCCN3CCC(N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CC3)cc21 |
| InChI | InChI=1S/C31H53N5O11/c1-3-34-18-35(4-2)22-13-19(5-6-21(22)34)31(47)32-9-12-33-10-7-20(8-11-33)36(14-23(39)27(43)29(45)25(41)16-37)15-24(40)28(44)30(46)26(42)17-38/h5-6,13,18,20,23-30,37-46H,3-4,7-12,14-17H2,1-2H3/p+1/t23-,24-,25+,26+,27+,28+,29+,30+/m0/s1 |
| InChIKey | IKJBZVRIAHCADG-UDNHBNEUSA-O |
| XLogP | -4.66 |
| TPSA | 246.69 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|