C27H47N4O11+ — CID 142755362
N-[3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide (PubChem CID 142755362) has the molecular formula C27H47N4O11+ and a molecular weight of 603.69 g/mol. Its IUPAC name is N-[3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide.
| Compound Name | N-[3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 142755362 |
| Molecular Formula | C27H47N4O11+ |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | N-[3-[bis[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]-1,3-diethylbenzimidazol-1-ium-5-carboxamide |
| SMILES | CCn1c[n+](CC)c2ccc(C(=O)NCCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc21 |
| InChI | InChI=1S/C27H46N4O11/c1-3-30-15-31(4-2)18-10-16(6-7-17(18)30)27(42)28-8-5-9-29(11-19(34)23(38)25(40)21(36)13-32)12-20(35)24(39)26(41)22(37)14-33/h6-7,10,15,19-26,32-41H,3-5,8-9,11-14H2,1-2H3/p+1/t19-,20-,21+,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | NJCHVCPISHMRHS-LPKNJJOBSA-O |
| XLogP | -4.74 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|