C13H18N2O — CID 80560661
1-N-(3,4-dihydro-2H-chromen-4-yl)cyclobutane-1,3-diamine (PubChem CID 80560661) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-N-(3,4-dihydro-2H-chromen-4-yl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(3,4-dihydro-2H-chromen-4-yl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80560661 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-N-(3,4-dihydro-2H-chromen-4-yl)cyclobutane-1,3-diamine |
| SMILES | NC1CC(NC2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C13H18N2O/c14-9-7-10(8-9)15-12-5-6-16-13-4-2-1-3-11(12)13/h1-4,9-10,12,15H,5-8,14H2 |
| InChIKey | BRLJPPQXRIEKSK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |