C17H28ClN3O2S — CID 120722191
6-amino-1-[[cyclohexyl(methyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene;hydrochloride (PubChem CID 120722191) has the molecular formula C17H28ClN3O2S and a molecular weight of 373.95 g/mol. Its IUPAC name is 6-amino-1-[[cyclohexyl(methyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene;hydrochloride.
| Compound Name | 6-amino-1-[[cyclohexyl(methyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene;hydrochloride |
|---|---|
| PubChem CID | 120722191 |
| Molecular Formula | C17H28ClN3O2S |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 6-amino-1-[[cyclohexyl(methyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene;hydrochloride |
| SMILES | CN(C1CCCCC1)S(=O)(=O)NC1CCCc2cc(N)ccc21.Cl |
| InChI | InChI=1S/C17H27N3O2S.ClH/c1-20(15-7-3-2-4-8-15)23(21,22)19-17-9-5-6-13-12-14(18)10-11-16(13)17;/h10-12,15,17,19H,2-9,18H2,1H3;1H |
| InChIKey | VRDVZMYCVLVXTA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|