C19H25N3O2S — CID 120722000
6-amino-1-[[benzyl(ethyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 120722000) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 6-amino-1-[[benzyl(ethyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-amino-1-[[benzyl(ethyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 120722000 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 6-amino-1-[[benzyl(ethyl)sulfamoyl]amino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)NC1CCCc2cc(N)ccc21 |
| InChI | InChI=1S/C19H25N3O2S/c1-2-22(14-15-7-4-3-5-8-15)25(23,24)21-19-10-6-9-16-13-17(20)11-12-18(16)19/h3-5,7-8,11-13,19,21H,2,6,9-10,14,20H2,1H3 |
| InChIKey | WCJJGWGASLDVBZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|