C19H22N2O4S — CID 120722237
methyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate (PubChem CID 120722237) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is methyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 120722237 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | methyl 3-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(CS(=O)(=O)NC2CCCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-25-19(22)15-6-2-4-13(10-15)12-26(23,24)21-18-7-3-5-14-11-16(20)8-9-17(14)18/h2,4,6,8-11,18,21H,3,5,7,12,20H2,1H3 |
| InChIKey | XOMNLKQAPXVILI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|