C19H23ClN2O4S — CID 120722252
methyl 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate;hydrochloride (PubChem CID 120722252) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is methyl 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate;hydrochloride.
| Compound Name | methyl 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120722252 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl 2-[(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoylmethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccccc1CS(=O)(=O)NC1CCCc2cc(N)ccc21.Cl |
| InChI | InChI=1S/C19H22N2O4S.ClH/c1-25-19(22)17-7-3-2-5-14(17)12-26(23,24)21-18-8-4-6-13-11-15(20)9-10-16(13)18;/h2-3,5,7,9-11,18,21H,4,6,8,12,20H2,1H3;1H |
| InChIKey | BUFBXFIRARXEDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|