C16H21ClN2O2S2 — CID 120876305
N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride (PubChem CID 120876305) has the molecular formula C16H21ClN2O2S2 and a molecular weight of 372.94 g/mol. Its IUPAC name is N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876305 |
| Molecular Formula | C16H21ClN2O2S2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CCCC2NS(=O)(=O)CCc1cccs1 |
| InChI | InChI=1S/C16H20N2O2S2.ClH/c17-13-6-7-15-12(11-13)3-1-5-16(15)18-22(19,20)10-8-14-4-2-9-21-14;/h2,4,6-7,9,11,16,18H,1,3,5,8,10,17H2;1H |
| InChIKey | HBCSJVNXFCDSHH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|