C9H13N5 — CID 107490038
6-N-(2-aminoethyl)-1H-indazole-5,6-diamine (PubChem CID 107490038) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 6-N-(2-aminoethyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(2-aminoethyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490038 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 6-N-(2-aminoethyl)-1H-indazole-5,6-diamine |
| SMILES | NCCNc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C9H13N5/c10-1-2-12-9-4-8-6(3-7(9)11)5-13-14-8/h3-5,12H,1-2,10-11H2,(H,13,14) |
| InChIKey | UEZMGLDTBLTLSN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|