C13H10ClIN4 — CID 107606267
6-N-(2-chloro-4-iodophenyl)-1H-indazole-5,6-diamine (PubChem CID 107606267) has the molecular formula C13H10ClIN4 and a molecular weight of 384.61 g/mol. Its IUPAC name is 6-N-(2-chloro-4-iodophenyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(2-chloro-4-iodophenyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107606267 |
| Molecular Formula | C13H10ClIN4 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 6-N-(2-chloro-4-iodophenyl)-1H-indazole-5,6-diamine |
| SMILES | Nc1cc2cn[nH]c2cc1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H10ClIN4/c14-9-4-8(15)1-2-11(9)18-13-5-12-7(3-10(13)16)6-17-19-12/h1-6,18H,16H2,(H,17,19) |
| InChIKey | SNMIESKIZLMANL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|