C12H11ClIN3 — CID 107606139
2-N-(2-chloro-4-iodophenyl)-6-methylpyridine-2,5-diamine (PubChem CID 107606139) has the molecular formula C12H11ClIN3 and a molecular weight of 359.60 g/mol. Its IUPAC name is 2-N-(2-chloro-4-iodophenyl)-6-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(2-chloro-4-iodophenyl)-6-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 107606139 |
| Molecular Formula | C12H11ClIN3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 2-N-(2-chloro-4-iodophenyl)-6-methylpyridine-2,5-diamine |
| SMILES | Cc1nc(Nc2ccc(I)cc2Cl)ccc1N |
| InChI | InChI=1S/C12H11ClIN3/c1-7-10(15)3-5-12(16-7)17-11-4-2-8(14)6-9(11)13/h2-6H,15H2,1H3,(H,16,17) |
| InChIKey | ZIYOIVYDQRFWKK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|