C13H10ClIN4S — CID 107604772
4-N-(2-chloro-4-iodophenyl)-6-methylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 107604772) has the molecular formula C13H10ClIN4S and a molecular weight of 416.68 g/mol. Its IUPAC name is 4-N-(2-chloro-4-iodophenyl)-6-methylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chloro-4-iodophenyl)-6-methylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 107604772 |
| Molecular Formula | C13H10ClIN4S |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 4-N-(2-chloro-4-iodophenyl)-6-methylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc2c(Nc3ccc(I)cc3Cl)nc(N)nc2s1 |
| InChI | InChI=1S/C13H10ClIN4S/c1-6-4-8-11(18-13(16)19-12(8)20-6)17-10-3-2-7(15)5-9(10)14/h2-5H,1H3,(H3,16,17,18,19) |
| InChIKey | TXAPCXGHKNDMSP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|