C13H7ClF3N3S — CID 103320354
2-chloro-6-methyl-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103320354) has the molecular formula C13H7ClF3N3S and a molecular weight of 329.73 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103320354 |
| Molecular Formula | C13H7ClF3N3S |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-chloro-6-methyl-N-(2,3,4-trifluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(Nc3ccc(F)c(F)c3F)nc(Cl)nc2s1 |
| InChI | InChI=1S/C13H7ClF3N3S/c1-5-4-6-11(19-13(14)20-12(6)21-5)18-8-3-2-7(15)9(16)10(8)17/h2-4H,1H3,(H,18,19,20) |
| InChIKey | ZMZPOXYRTPQZAV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|