C16H11ClN4S — CID 82065968
2-chloro-6-methyl-N-quinolin-8-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 82065968) has the molecular formula C16H11ClN4S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-quinolin-8-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-N-quinolin-8-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82065968 |
| Molecular Formula | C16H11ClN4S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-chloro-6-methyl-N-quinolin-8-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(Nc3cccc4cccnc34)nc(Cl)nc2s1 |
| InChI | InChI=1S/C16H11ClN4S/c1-9-8-11-14(20-16(17)21-15(11)22-9)19-12-6-2-4-10-5-3-7-18-13(10)12/h2-8H,1H3,(H,19,20,21) |
| InChIKey | OMLWVRGSPCYFAR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |