C17H18N2S — CID 43103063
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]quinolin-8-amine (PubChem CID 43103063) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]quinolin-8-amine.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]quinolin-8-amine |
|---|---|
| PubChem CID | 43103063 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]quinolin-8-amine |
| SMILES | Cc1cc(C(C)Nc2cccc3cccnc23)c(C)s1 |
| InChI | InChI=1S/C17H18N2S/c1-11-10-15(13(3)20-11)12(2)19-16-8-4-6-14-7-5-9-18-17(14)16/h4-10,12,19H,1-3H3 |
| InChIKey | RIEZPKYUVYPBIG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |