C17H17N3S — CID 20851243
N-[(E)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]quinolin-8-amine (PubChem CID 20851243) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]quinolin-8-amine.
| Compound Name | N-[(E)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]quinolin-8-amine |
|---|---|
| PubChem CID | 20851243 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[(E)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]quinolin-8-amine |
| SMILES | C/C(=N\Nc1cccc2cccnc12)c1cc(C)sc1C |
| InChI | InChI=1S/C17H17N3S/c1-11-10-15(13(3)21-11)12(2)19-20-16-8-4-6-14-7-5-9-18-17(14)16/h4-10,20H,1-3H3/b19-12+ |
| InChIKey | SOOWQEMYCDZODT-XDHOZWIPSA-N |
| XLogP | 4.75 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|