C12H8Cl3IN2 — CID 66066255
4-iodo-1-N-(2,4,5-trichlorophenyl)benzene-1,2-diamine (PubChem CID 66066255) has the molecular formula C12H8Cl3IN2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-iodo-1-N-(2,4,5-trichlorophenyl)benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-(2,4,5-trichlorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 66066255 |
| Molecular Formula | C12H8Cl3IN2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | 4-iodo-1-N-(2,4,5-trichlorophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3IN2/c13-7-4-9(15)12(5-8(7)14)18-11-2-1-6(16)3-10(11)17/h1-5,18H,17H2 |
| InChIKey | GFXZFIIJRBQVAJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|