C12H7Cl5N2 — CID 106889857
2,6-dichloro-1-N-(2,4,5-trichlorophenyl)benzene-1,4-diamine (PubChem CID 106889857) has the molecular formula C12H7Cl5N2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(2,4,5-trichlorophenyl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(2,4,5-trichlorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106889857 |
| Molecular Formula | C12H7Cl5N2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 2,6-dichloro-1-N-(2,4,5-trichlorophenyl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(Nc2cc(Cl)c(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl5N2/c13-6-3-8(15)11(4-7(6)14)19-12-9(16)1-5(18)2-10(12)17/h1-4,19H,18H2 |
| InChIKey | DGXFUORDIHVYPT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|