C14H15Cl2N3 — CID 106890898
2,6-dichloro-1-N-[2-(dimethylamino)phenyl]benzene-1,4-diamine (PubChem CID 106890898) has the molecular formula C14H15Cl2N3 and a molecular weight of 296.20 g/mol. Its IUPAC name is 2,6-dichloro-1-N-[2-(dimethylamino)phenyl]benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-[2-(dimethylamino)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890898 |
| Molecular Formula | C14H15Cl2N3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2,6-dichloro-1-N-[2-(dimethylamino)phenyl]benzene-1,4-diamine |
| SMILES | CN(C)c1ccccc1Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3/c1-19(2)13-6-4-3-5-12(13)18-14-10(15)7-9(17)8-11(14)16/h3-8,18H,17H2,1-2H3 |
| InChIKey | GDSKHHLWGICYFA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|