C15H18FN3 — CID 106759459
1-N-[2-(dimethylamino)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine (PubChem CID 106759459) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine.
| Compound Name | 1-N-[2-(dimethylamino)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 106759459 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-N-[2-(dimethylamino)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(Nc2ccccc2N(C)C)c(N)cc1F |
| InChI | InChI=1S/C15H18FN3/c1-10-8-14(12(17)9-11(10)16)18-13-6-4-5-7-15(13)19(2)3/h4-9,18H,17H2,1-3H3 |
| InChIKey | OEPYLWAUMBDFCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|