About 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid
4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid (PubChem CID 106760102) has the molecular formula C15H14F2N2O2
and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid |
| PubChem CID | 106760102 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid |
| SMILES | CN(C)c1ccccc1Nc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C15H14F2N2O2/c1-19(2)13-6-4-3-5-12(13)18-14-10(16)7-9(15(20)21)8-11(14)17/h3-8,18H,1-2H3,(H,20,21) |
| InChIKey | GXEURWJBMCYWEV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid?
The IUPAC name of 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid (CID 106760102) is 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid?
The canonical SMILES for 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid is CN(C)c1ccccc1Nc1c(F)cc(C(=O)O)cc1F.
What is the InChIKey of 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid?
The InChIKey is GXEURWJBMCYWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O2/c1-19(2)13-6-4-3-5-12(13)18-14-10(16)7-9(15(20)21)8-11(14)17/h3-8,18H,1-2H3,(H,20,21).
What are the key properties of 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid?
4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid has a molecular weight of 292.29 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethylamino)anilino]-3,5-difluorobenzoic acid is sourced from PubChem (CID 106760102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).