3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid

C13H6Cl3F2NO2 — CID 63526952

IUPAC3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid
SMILESO=C(O)c1cc(F)c(Nc2cc(Cl)c(Cl)cc2Cl)c(F)c1
InChIInChI=1S/C13H6Cl3F2NO2/c14-6-3-8(16)11(4-7(6)15)19-12-9(17)1-5(13(20)21)2-10(12)18/h1-4,19H,(H,20,21)
InChIKeyMYIAAYLMYWUCPY-UHFFFAOYSA-N
MW352.55 g/mol
LogP5.37
Rot. Bonds3

About 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid

3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid (PubChem CID 63526952) has the molecular formula C13H6Cl3F2NO2 and a molecular weight of 352.55 g/mol. Its IUPAC name is 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid.

Molecular Properties

Compound Name3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid
PubChem CID63526952
Molecular FormulaC13H6Cl3F2NO2
Molecular Weight352.55 g/mol
Exact Mass350.94
IUPAC Name3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid
SMILESO=C(O)c1cc(F)c(Nc2cc(Cl)c(Cl)cc2Cl)c(F)c1
InChIInChI=1S/C13H6Cl3F2NO2/c14-6-3-8(16)11(4-7(6)15)19-12-9(17)1-5(13(20)21)2-10(12)18/h1-4,19H,(H,20,21)
InChIKeyMYIAAYLMYWUCPY-UHFFFAOYSA-N
XLogP5.37
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500352.55
LogP ≤ 55.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid?
The IUPAC name of 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid (CID 63526952) is 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid.
What is the SMILES notation for 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid?
The canonical SMILES for 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid is O=C(O)c1cc(F)c(Nc2cc(Cl)c(Cl)cc2Cl)c(F)c1.
What is the InChIKey of 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid?
The InChIKey is MYIAAYLMYWUCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl3F2NO2/c14-6-3-8(16)11(4-7(6)15)19-12-9(17)1-5(13(20)21)2-10(12)18/h1-4,19H,(H,20,21).
What are the key properties of 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid?
3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid has a molecular weight of 352.55 g/mol, XLogP of 5.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-(2,4,5-trichloroanilino)benzoic acid is sourced from PubChem (CID 63526952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).