C10H9Cl2N3O — CID 15294526
2,6-dichloro-1-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,4-diamine (PubChem CID 15294526) has the molecular formula C10H9Cl2N3O and a molecular weight of 258.11 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 15294526 |
| Molecular Formula | C10H9Cl2N3O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2,6-dichloro-1-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,4-diamine |
| SMILES | Cc1cc(Nc2c(Cl)cc(N)cc2Cl)no1 |
| InChI | InChI=1S/C10H9Cl2N3O/c1-5-2-9(15-16-5)14-10-7(11)3-6(13)4-8(10)12/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | XPFNUDZGXBCDPJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|