C10H11ClN4O — CID 104924020
6-chloro-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyridine-2,4-diamine (PubChem CID 104924020) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 6-chloro-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104924020 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 6-chloro-2-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyridine-2,4-diamine |
| SMILES | Cc1cc(CNc2cc(N)cc(Cl)n2)no1 |
| InChI | InChI=1S/C10H11ClN4O/c1-6-2-8(15-16-6)5-13-10-4-7(12)3-9(11)14-10/h2-4H,5H2,1H3,(H3,12,13,14) |
| InChIKey | DAVQWJUYYBCDDD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|