C11H9ClIN3 — CID 156571441
1-N-(6-chloro-3-pyridinyl)-4-iodobenzene-1,2-diamine (PubChem CID 156571441) has the molecular formula C11H9ClIN3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 1-N-(6-chloro-3-pyridinyl)-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-(6-chloro-3-pyridinyl)-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 156571441 |
| Molecular Formula | C11H9ClIN3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 1-N-(6-chloro-3-pyridinyl)-4-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H9ClIN3/c12-11-4-2-8(6-15-11)16-10-3-1-7(13)5-9(10)14/h1-6,16H,14H2 |
| InChIKey | UVROCHMIKRRWOX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|