C11H13IN4 — CID 156571539
1-N-(1-ethylpyrazol-4-yl)-4-iodobenzene-1,2-diamine (PubChem CID 156571539) has the molecular formula C11H13IN4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 1-N-(1-ethylpyrazol-4-yl)-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-(1-ethylpyrazol-4-yl)-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 156571539 |
| Molecular Formula | C11H13IN4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 1-N-(1-ethylpyrazol-4-yl)-4-iodobenzene-1,2-diamine |
| SMILES | CCn1cc(Nc2ccc(I)cc2N)cn1 |
| InChI | InChI=1S/C11H13IN4/c1-2-16-7-9(6-14-16)15-11-4-3-8(12)5-10(11)13/h3-7,15H,2,13H2,1H3 |
| InChIKey | BLUSGBYIDGFQHB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|