C10H14N6O — CID 114053016
4-N-(1-ethylpyrazol-4-yl)-6-methoxypyrimidine-2,4-diamine (PubChem CID 114053016) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-N-(1-ethylpyrazol-4-yl)-6-methoxypyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-ethylpyrazol-4-yl)-6-methoxypyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114053016 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-N-(1-ethylpyrazol-4-yl)-6-methoxypyrimidine-2,4-diamine |
| SMILES | CCn1cc(Nc2cc(OC)nc(N)n2)cn1 |
| InChI | InChI=1S/C10H14N6O/c1-3-16-6-7(5-12-16)13-8-4-9(17-2)15-10(11)14-8/h4-6H,3H2,1-2H3,(H3,11,13,14,15) |
| InChIKey | JPIPMFSWFKATOS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |