C11H13N5O2 — CID 66285222
methyl 4-[(1-ethylpyrazol-4-yl)amino]pyrimidine-2-carboxylate (PubChem CID 66285222) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is methyl 4-[(1-ethylpyrazol-4-yl)amino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-[(1-ethylpyrazol-4-yl)amino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66285222 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | methyl 4-[(1-ethylpyrazol-4-yl)amino]pyrimidine-2-carboxylate |
| SMILES | CCn1cc(Nc2ccnc(C(=O)OC)n2)cn1 |
| InChI | InChI=1S/C11H13N5O2/c1-3-16-7-8(6-13-16)14-9-4-5-12-10(15-9)11(17)18-2/h4-7H,3H2,1-2H3,(H,12,14,15) |
| InChIKey | UUWUVAMFPKCWJK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |