C11H17N5O3 — CID 83114374
methyl 4-[2-(dimethylcarbamoylamino)ethylamino]pyrimidine-2-carboxylate (PubChem CID 83114374) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is methyl 4-[2-(dimethylcarbamoylamino)ethylamino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-[2-(dimethylcarbamoylamino)ethylamino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 83114374 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl 4-[2-(dimethylcarbamoylamino)ethylamino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H17N5O3/c1-16(2)11(18)14-7-6-12-8-4-5-13-9(15-8)10(17)19-3/h4-5H,6-7H2,1-3H3,(H,14,18)(H,12,13,15) |
| InChIKey | ROYUJNGSNKXMCB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|