C11H13N3O2 — CID 116644639
methyl 4-(pent-3-ynylamino)pyrimidine-2-carboxylate (PubChem CID 116644639) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl 4-(pent-3-ynylamino)pyrimidine-2-carboxylate.
| Compound Name | methyl 4-(pent-3-ynylamino)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 116644639 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | methyl 4-(pent-3-ynylamino)pyrimidine-2-carboxylate |
| SMILES | CC#CCCNc1ccnc(C(=O)OC)n1 |
| InChI | InChI=1S/C11H13N3O2/c1-3-4-5-7-12-9-6-8-13-10(14-9)11(15)16-2/h6,8H,5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | JJFAXPHZKISLLU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|