C10H11N5O2 — CID 66286447
methyl 4-(1H-pyrazol-5-ylmethylamino)pyrimidine-2-carboxylate (PubChem CID 66286447) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is methyl 4-(1H-pyrazol-5-ylmethylamino)pyrimidine-2-carboxylate.
| Compound Name | methyl 4-(1H-pyrazol-5-ylmethylamino)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66286447 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | methyl 4-(1H-pyrazol-5-ylmethylamino)pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NCc2ccn[nH]2)n1 |
| InChI | InChI=1S/C10H11N5O2/c1-17-10(16)9-11-4-3-8(14-9)12-6-7-2-5-13-15-7/h2-5H,6H2,1H3,(H,13,15)(H,11,12,14) |
| InChIKey | CHAINEACMHIWCE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |