C11H15N3O4 — CID 81066836
4-[(2-methoxycarbonylpyrimidin-4-yl)amino]-3-methylbutanoic acid (PubChem CID 81066836) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-[(2-methoxycarbonylpyrimidin-4-yl)amino]-3-methylbutanoic acid.
| Compound Name | 4-[(2-methoxycarbonylpyrimidin-4-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81066836 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[(2-methoxycarbonylpyrimidin-4-yl)amino]-3-methylbutanoic acid |
| SMILES | COC(=O)c1nccc(NCC(C)CC(=O)O)n1 |
| InChI | InChI=1S/C11H15N3O4/c1-7(5-9(15)16)6-13-8-3-4-12-10(14-8)11(17)18-2/h3-4,7H,5-6H2,1-2H3,(H,15,16)(H,12,13,14) |
| InChIKey | IHBHCDYICCCWTF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |