C10H12N6O2 — CID 113412962
methyl 4-[2-(triazol-1-yl)ethylamino]pyrimidine-2-carboxylate (PubChem CID 113412962) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is methyl 4-[2-(triazol-1-yl)ethylamino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-[2-(triazol-1-yl)ethylamino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 113412962 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | methyl 4-[2-(triazol-1-yl)ethylamino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NCCn2ccnn2)n1 |
| InChI | InChI=1S/C10H12N6O2/c1-18-10(17)9-12-3-2-8(14-9)11-4-6-16-7-5-13-15-16/h2-3,5,7H,4,6H2,1H3,(H,11,12,14) |
| InChIKey | LZIASIJXDWKQCC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |