C20H16N4O3 — CID 51329615
N-[5-(1H-indazol-5-ylcarbamoyl)-2-methylphenyl]furan-2-carboxamide (PubChem CID 51329615) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[5-(1H-indazol-5-ylcarbamoyl)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-(1H-indazol-5-ylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51329615 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[5-(1H-indazol-5-ylcarbamoyl)-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3[nH]ncc3c2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H16N4O3/c1-12-4-5-13(10-17(12)23-20(26)18-3-2-8-27-18)19(25)22-15-6-7-16-14(9-15)11-21-24-16/h2-11H,1H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | GOPZIBLLVCNJFR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |