C18H18N4O2S — CID 17099398
N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17099398) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17099398 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1n[nH]c(C)c1Cc1ccc(NC(=S)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-11-15(12(2)22-21-11)10-13-5-7-14(8-6-13)19-18(25)20-17(23)16-4-3-9-24-16/h3-9H,10H2,1-2H3,(H,21,22)(H2,19,20,23,25) |
| InChIKey | VOQRPHINVCFDJZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|