C24H20Cl2N4O2S — CID 17112324
5-(2,5-dichlorophenyl)-N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17112324) has the molecular formula C24H20Cl2N4O2S and a molecular weight of 499.42 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17112324 |
| Molecular Formula | C24H20Cl2N4O2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1n[nH]c(C)c1Cc1ccc(NC(=S)NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O2S/c1-13-18(14(2)30-29-13)11-15-3-6-17(7-4-15)27-24(33)28-23(31)22-10-9-21(32-22)19-12-16(25)5-8-20(19)26/h3-10,12H,11H2,1-2H3,(H,29,30)(H2,27,28,31,33) |
| InChIKey | YXMZRQQUQPPDLH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|