C18H12Cl2IN3O2S — CID 17316537
5-(2,5-dichlorophenyl)-N-[(5-iodo-6-methyl-2-pyridinyl)carbamothioyl]furan-2-carboxamide (PubChem CID 17316537) has the molecular formula C18H12Cl2IN3O2S and a molecular weight of 532.19 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-N-[(5-iodo-6-methyl-2-pyridinyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,5-dichlorophenyl)-N-[(5-iodo-6-methyl-2-pyridinyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17316537 |
| Molecular Formula | C18H12Cl2IN3O2S |
| Molecular Weight | 532.19 g/mol |
| Exact Mass | 530.91 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-N-[(5-iodo-6-methyl-2-pyridinyl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1nc(NC(=S)NC(=O)c2ccc(-c3cc(Cl)ccc3Cl)o2)ccc1I |
| InChI | InChI=1S/C18H12Cl2IN3O2S/c1-9-13(21)4-7-16(22-9)23-18(27)24-17(25)15-6-5-14(26-15)11-8-10(19)2-3-12(11)20/h2-8H,1H3,(H2,22,23,24,25,27) |
| InChIKey | DNJPRSRGIDYBRU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.19 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|