C24H26N6O4S — CID 17113805
N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17113805) has the molecular formula C24H26N6O4S and a molecular weight of 494.58 g/mol. Its IUPAC name is N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17113805 |
| Molecular Formula | C24H26N6O4S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[[4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1n[nH]c(C)c1Cc1ccc(NC(=S)NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H26N6O4S/c1-15-20(16(2)28-27-15)13-17-3-6-19(7-4-17)25-24(35)26-23(31)18-5-8-21(22(14-18)30(32)33)29-9-11-34-12-10-29/h3-8,14H,9-13H2,1-2H3,(H,27,28)(H2,25,26,31,35) |
| InChIKey | RNZGJIFKAQYSBV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|