C21H17ClF3N3O2 — CID 172960879
4-[3-chloro-5-(trifluoromethyl)phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-4-oxobutanamide (PubChem CID 172960879) has the molecular formula C21H17ClF3N3O2 and a molecular weight of 435.83 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-4-oxobutanamide.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-4-oxobutanamide |
|---|---|
| PubChem CID | 172960879 |
| Molecular Formula | C21H17ClF3N3O2 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-4-oxobutanamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)CCC(=O)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF3N3O2/c1-12-17(16-4-2-3-5-18(16)27-12)11-26-28-20(30)7-6-19(29)13-8-14(21(23,24)25)10-15(22)9-13/h2-5,8-11,27H,6-7H2,1H3,(H,28,30)/b26-11+ |
| InChIKey | TXRSKEFKBAERFA-KBKYJPHKSA-N |
| XLogP | 5.26 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|