C19H18ClN3OS — CID 136874831
2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]acetamide (PubChem CID 136874831) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136874831 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(5-chloro-2-methylsulfanylphenyl)-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]acetamide |
| SMILES | CSc1ccc(Cl)cc1CC(=O)N/N=C\c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18ClN3OS/c1-12-16(15-5-3-4-6-17(15)22-12)11-21-23-19(24)10-13-9-14(20)7-8-18(13)25-2/h3-9,11,22H,10H2,1-2H3,(H,23,24)/b21-11- |
| InChIKey | WDZCYXJBRJBTKW-NHDPSOOVSA-N |
| XLogP | 4.54 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|