C21H17N5O2S — CID 137156123
N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 137156123) has the molecular formula C21H17N5O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137156123 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[2-oxo-2-[2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CNC(=O)c1cscn1)NN=Cc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H17N5O2S/c27-19(11-22-21(28)18-12-29-13-23-18)26-24-10-16-15-8-4-5-9-17(15)25-20(16)14-6-2-1-3-7-14/h1-10,12-13,25H,11H2,(H,22,28)(H,26,27) |
| InChIKey | DOJRQQNMSNWRAR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|