C22H21N5O — CID 4854849
2-(3,5-dimethylpyrazol-1-yl)-N-[(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide (PubChem CID 4854849) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4854849 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NN=Cc2c(-c3ccccc3)[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C22H21N5O/c1-15-12-16(2)27(26-15)14-21(28)25-23-13-19-18-10-6-7-11-20(18)24-22(19)17-8-4-3-5-9-17/h3-13,24H,14H2,1-2H3,(H,25,28) |
| InChIKey | JFSRMZLVDGPNHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|