C12H10Br2F3NO3 — CID 103492494
methyl 2-bromo-3-[[2-bromo-5-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 103492494) has the molecular formula C12H10Br2F3NO3 and a molecular weight of 433.02 g/mol. Its IUPAC name is methyl 2-bromo-3-[[2-bromo-5-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | methyl 2-bromo-3-[[2-bromo-5-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 103492494 |
| Molecular Formula | C12H10Br2F3NO3 |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | methyl 2-bromo-3-[[2-bromo-5-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H10Br2F3NO3/c1-21-11(20)9(14)5-18-10(19)7-4-6(12(15,16)17)2-3-8(7)13/h2-4,9H,5H2,1H3,(H,18,19) |
| InChIKey | FUHRIBQMWYWOKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|