C18H21NO5 — CID 122118636
1-(6-methoxy-2H-chromene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122118636) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(6-methoxy-2H-chromene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(6-methoxy-2H-chromene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118636 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(6-methoxy-2H-chromene-3-carbonyl)-5-methylpiperidine-3-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(C(=O)N1CC(C)CC(C(=O)O)C1)CO2 |
| InChI | InChI=1S/C18H21NO5/c1-11-5-13(18(21)22)9-19(8-11)17(20)14-6-12-7-15(23-2)3-4-16(12)24-10-14/h3-4,6-7,11,13H,5,8-10H2,1-2H3,(H,21,22) |
| InChIKey | MTZVWXPCBKQFLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |