1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid

C16H21NO5 — CID 122117578

IUPAC1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid
SMILESCOc1cccc(OC)c1C(=O)N1CC(C)CC(C(=O)O)C1
InChIInChI=1S/C16H21NO5/c1-10-7-11(16(19)20)9-17(8-10)15(18)14-12(21-2)5-4-6-13(14)22-3/h4-6,10-11H,7-9H2,1-3H3,(H,19,20)
InChIKeyPNCDMLDKDLTQPF-UHFFFAOYSA-N
MW307.35 g/mol
LogP1.89
Rot. Bonds4

About 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid

1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122117578) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid
PubChem CID122117578
Molecular FormulaC16H21NO5
Molecular Weight307.35 g/mol
Exact Mass307.14
IUPAC Name1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid
SMILESCOc1cccc(OC)c1C(=O)N1CC(C)CC(C(=O)O)C1
InChIInChI=1S/C16H21NO5/c1-10-7-11(16(19)20)9-17(8-10)15(18)14-12(21-2)5-4-6-13(14)22-3/h4-6,10-11H,7-9H2,1-3H3,(H,19,20)
InChIKeyPNCDMLDKDLTQPF-UHFFFAOYSA-N
XLogP1.89
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid?
The IUPAC name of 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid (CID 122117578) is 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid?
The canonical SMILES for 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid is COc1cccc(OC)c1C(=O)N1CC(C)CC(C(=O)O)C1.
What is the InChIKey of 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid?
The InChIKey is PNCDMLDKDLTQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO5/c1-10-7-11(16(19)20)9-17(8-10)15(18)14-12(21-2)5-4-6-13(14)22-3/h4-6,10-11H,7-9H2,1-3H3,(H,19,20).
What are the key properties of 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid?
1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid has a molecular weight of 307.35 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethoxybenzoyl)-5-methylpiperidine-3-carboxylic acid is sourced from PubChem (CID 122117578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).